C19H13NO6 — CID 7779189
(4Z)-2-(1,3-benzodioxol-5-yl)-4-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-1,3-oxazol-5-one (PubChem CID 7779189) has the molecular formula C19H13NO6 and a molecular weight of 351.31 g/mol. Its IUPAC name is (4Z)-2-(1,3-benzodioxol-5-yl)-4-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-1,3-oxazol-5-one.
| Compound Name | (4Z)-2-(1,3-benzodioxol-5-yl)-4-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 7779189 |
| Molecular Formula | C19H13NO6 |
| Molecular Weight | 351.31 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | (4Z)-2-(1,3-benzodioxol-5-yl)-4-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-1,3-oxazol-5-one |
| SMILES | O=C1OC(c2ccc3c(c2)OCO3)=N/C1=C\c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C19H13NO6/c21-19-13(7-11-1-3-14-16(8-11)23-6-5-22-14)20-18(26-19)12-2-4-15-17(9-12)25-10-24-15/h1-4,7-9H,5-6,10H2/b13-7- |
| InChIKey | IQPBYGOZZMRSNM-QPEQYQDCSA-N |
| XLogP | 2.53 |
| TPSA | 75.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.31 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|