C20H16Cl2N2O3 — CID 9312801
(4Z)-2-(2,4-dichlorophenyl)-4-[(4-morpholin-4-ylphenyl)methylidene]-1,3-oxazol-5-one (PubChem CID 9312801) has the molecular formula C20H16Cl2N2O3 and a molecular weight of 403.27 g/mol. Its IUPAC name is (4Z)-2-(2,4-dichlorophenyl)-4-[(4-morpholin-4-ylphenyl)methylidene]-1,3-oxazol-5-one.
| Compound Name | (4Z)-2-(2,4-dichlorophenyl)-4-[(4-morpholin-4-ylphenyl)methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 9312801 |
| Molecular Formula | C20H16Cl2N2O3 |
| Molecular Weight | 403.27 g/mol |
| Exact Mass | 402.05 |
| IUPAC Name | (4Z)-2-(2,4-dichlorophenyl)-4-[(4-morpholin-4-ylphenyl)methylidene]-1,3-oxazol-5-one |
| SMILES | O=C1OC(c2ccc(Cl)cc2Cl)=N/C1=C\c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C20H16Cl2N2O3/c21-14-3-6-16(17(22)12-14)19-23-18(20(25)27-19)11-13-1-4-15(5-2-13)24-7-9-26-10-8-24/h1-6,11-12H,7-10H2/b18-11- |
| InChIKey | DSXORZFQFPVUPD-WQRHYEAKSA-N |
| XLogP | 4.17 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.27 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|