C14H6BrCl2NO2S — CID 6293358
(4Z)-4-[(4-bromothiophen-2-yl)methylidene]-2-(2,4-dichlorophenyl)-1,3-oxazol-5-one (PubChem CID 6293358) has the molecular formula C14H6BrCl2NO2S and a molecular weight of 403.08 g/mol. Its IUPAC name is (4Z)-4-[(4-bromothiophen-2-yl)methylidene]-2-(2,4-dichlorophenyl)-1,3-oxazol-5-one.
| Compound Name | (4Z)-4-[(4-bromothiophen-2-yl)methylidene]-2-(2,4-dichlorophenyl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 6293358 |
| Molecular Formula | C14H6BrCl2NO2S |
| Molecular Weight | 403.08 g/mol |
| Exact Mass | 400.87 |
| IUPAC Name | (4Z)-4-[(4-bromothiophen-2-yl)methylidene]-2-(2,4-dichlorophenyl)-1,3-oxazol-5-one |
| SMILES | O=C1OC(c2ccc(Cl)cc2Cl)=N/C1=C\c1cc(Br)cs1 |
| InChI | InChI=1S/C14H6BrCl2NO2S/c15-7-3-9(21-6-7)5-12-14(19)20-13(18-12)10-2-1-8(16)4-11(10)17/h1-6H/b12-5- |
| InChIKey | XNDLSDDDRAZHHC-XGICHPGQSA-N |
| XLogP | 5.16 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.08 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|