C16H7Cl3FNO2 — CID 6997797
(4E)-4-[(2-chloro-6-fluorophenyl)methylidene]-2-(2,4-dichlorophenyl)-1,3-oxazol-5-one (PubChem CID 6997797) has the molecular formula C16H7Cl3FNO2 and a molecular weight of 370.59 g/mol. Its IUPAC name is (4E)-4-[(2-chloro-6-fluorophenyl)methylidene]-2-(2,4-dichlorophenyl)-1,3-oxazol-5-one.
| Compound Name | (4E)-4-[(2-chloro-6-fluorophenyl)methylidene]-2-(2,4-dichlorophenyl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 6997797 |
| Molecular Formula | C16H7Cl3FNO2 |
| Molecular Weight | 370.59 g/mol |
| Exact Mass | 368.95 |
| IUPAC Name | (4E)-4-[(2-chloro-6-fluorophenyl)methylidene]-2-(2,4-dichlorophenyl)-1,3-oxazol-5-one |
| SMILES | O=C1OC(c2ccc(Cl)cc2Cl)=N/C1=C/c1c(F)cccc1Cl |
| InChI | InChI=1S/C16H7Cl3FNO2/c17-8-4-5-9(12(19)6-8)15-21-14(16(22)23-15)7-10-11(18)2-1-3-13(10)20/h1-7H/b14-7+ |
| InChIKey | ZKRLMWPTSMHNKN-VGOFMYFVSA-N |
| XLogP | 5.13 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.59 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|