C15H9BrClNO3S — CID 4593945
4-[(4-bromothiophen-2-yl)methylidene]-2-(5-chloro-2-methoxyphenyl)-1,3-oxazol-5-one (PubChem CID 4593945) has the molecular formula C15H9BrClNO3S and a molecular weight of 398.67 g/mol. Its IUPAC name is 4-[(4-bromothiophen-2-yl)methylidene]-2-(5-chloro-2-methoxyphenyl)-1,3-oxazol-5-one.
| Compound Name | 4-[(4-bromothiophen-2-yl)methylidene]-2-(5-chloro-2-methoxyphenyl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 4593945 |
| Molecular Formula | C15H9BrClNO3S |
| Molecular Weight | 398.67 g/mol |
| Exact Mass | 396.92 |
| IUPAC Name | 4-[(4-bromothiophen-2-yl)methylidene]-2-(5-chloro-2-methoxyphenyl)-1,3-oxazol-5-one |
| SMILES | COc1ccc(Cl)cc1C1=NC(=Cc2cc(Br)cs2)C(=O)O1 |
| InChI | InChI=1S/C15H9BrClNO3S/c1-20-13-3-2-9(17)5-11(13)14-18-12(15(19)21-14)6-10-4-8(16)7-22-10/h2-7H,1H3 |
| InChIKey | UOQRYLABGYMNNB-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.67 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|