C16H12BrNO4S — CID 3687223
4-[(4-bromothiophen-2-yl)methylidene]-2-(3,4-dimethoxyphenyl)-1,3-oxazol-5-one (PubChem CID 3687223) has the molecular formula C16H12BrNO4S and a molecular weight of 394.25 g/mol. Its IUPAC name is 4-[(4-bromothiophen-2-yl)methylidene]-2-(3,4-dimethoxyphenyl)-1,3-oxazol-5-one.
| Compound Name | 4-[(4-bromothiophen-2-yl)methylidene]-2-(3,4-dimethoxyphenyl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 3687223 |
| Molecular Formula | C16H12BrNO4S |
| Molecular Weight | 394.25 g/mol |
| Exact Mass | 392.97 |
| IUPAC Name | 4-[(4-bromothiophen-2-yl)methylidene]-2-(3,4-dimethoxyphenyl)-1,3-oxazol-5-one |
| SMILES | COc1ccc(C2=NC(=Cc3cc(Br)cs3)C(=O)O2)cc1OC |
| InChI | InChI=1S/C16H12BrNO4S/c1-20-13-4-3-9(5-14(13)21-2)15-18-12(16(19)22-15)7-11-6-10(17)8-23-11/h3-8H,1-2H3 |
| InChIKey | ZQDBCBWGKGVANE-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.25 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|