C18H13Cl2NO4 — CID 46368712
(4E)-4-[(2,3-dichlorophenyl)methylidene]-2-(3,4-dimethoxyphenyl)-1,3-oxazol-5-one (PubChem CID 46368712) has the molecular formula C18H13Cl2NO4 and a molecular weight of 378.21 g/mol. Its IUPAC name is (4E)-4-[(2,3-dichlorophenyl)methylidene]-2-(3,4-dimethoxyphenyl)-1,3-oxazol-5-one.
| Compound Name | (4E)-4-[(2,3-dichlorophenyl)methylidene]-2-(3,4-dimethoxyphenyl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 46368712 |
| Molecular Formula | C18H13Cl2NO4 |
| Molecular Weight | 378.21 g/mol |
| Exact Mass | 377.02 |
| IUPAC Name | (4E)-4-[(2,3-dichlorophenyl)methylidene]-2-(3,4-dimethoxyphenyl)-1,3-oxazol-5-one |
| SMILES | COc1ccc(C2=N/C(=C/c3cccc(Cl)c3Cl)C(=O)O2)cc1OC |
| InChI | InChI=1S/C18H13Cl2NO4/c1-23-14-7-6-11(9-15(14)24-2)17-21-13(18(22)25-17)8-10-4-3-5-12(19)16(10)20/h3-9H,1-2H3/b13-8+ |
| InChIKey | LZQZJWUYUYSCOV-MDWZMJQESA-N |
| XLogP | 4.36 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.21 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|