C20H17Cl2NO3 — CID 3325334
2-(4-butoxyphenyl)-4-[(2,3-dichlorophenyl)methylidene]-1,3-oxazol-5-one (PubChem CID 3325334) has the molecular formula C20H17Cl2NO3 and a molecular weight of 390.27 g/mol. Its IUPAC name is 2-(4-butoxyphenyl)-4-[(2,3-dichlorophenyl)methylidene]-1,3-oxazol-5-one.
| Compound Name | 2-(4-butoxyphenyl)-4-[(2,3-dichlorophenyl)methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 3325334 |
| Molecular Formula | C20H17Cl2NO3 |
| Molecular Weight | 390.27 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | 2-(4-butoxyphenyl)-4-[(2,3-dichlorophenyl)methylidene]-1,3-oxazol-5-one |
| SMILES | CCCCOc1ccc(C2=NC(=Cc3cccc(Cl)c3Cl)C(=O)O2)cc1 |
| InChI | InChI=1S/C20H17Cl2NO3/c1-2-3-11-25-15-9-7-13(8-10-15)19-23-17(20(24)26-19)12-14-5-4-6-16(21)18(14)22/h4-10,12H,2-3,11H2,1H3 |
| InChIKey | JIQSQFHCCPPFLJ-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.27 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|