C27H22ClNO5 — CID 126010360
[4-[(Z)-[2-(4-butoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 2-chlorobenzoate (PubChem CID 126010360) has the molecular formula C27H22ClNO5 and a molecular weight of 475.93 g/mol. Its IUPAC name is [4-[(Z)-[2-(4-butoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 2-chlorobenzoate.
| Compound Name | [4-[(Z)-[2-(4-butoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 2-chlorobenzoate |
|---|---|
| PubChem CID | 126010360 |
| Molecular Formula | C27H22ClNO5 |
| Molecular Weight | 475.93 g/mol |
| Exact Mass | 475.12 |
| IUPAC Name | [4-[(Z)-[2-(4-butoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 2-chlorobenzoate |
| SMILES | CCCCOc1ccc(C2=N/C(=C\c3ccc(OC(=O)c4ccccc4Cl)cc3)C(=O)O2)cc1 |
| InChI | InChI=1S/C27H22ClNO5/c1-2-3-16-32-20-14-10-19(11-15-20)25-29-24(27(31)34-25)17-18-8-12-21(13-9-18)33-26(30)22-6-4-5-7-23(22)28/h4-15,17H,2-3,16H2,1H3/b24-17- |
| InChIKey | KSNNZALRCDHKKS-ULJHMMPZSA-N |
| XLogP | 6.08 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.93 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|