C24H23NO7 — CID 6737568
[2-acetyloxy-4-[[2-(4-butoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] acetate (PubChem CID 6737568) has the molecular formula C24H23NO7 and a molecular weight of 437.45 g/mol. Its IUPAC name is [2-acetyloxy-4-[[2-(4-butoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] acetate.
| Compound Name | [2-acetyloxy-4-[[2-(4-butoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] acetate |
|---|---|
| PubChem CID | 6737568 |
| Molecular Formula | C24H23NO7 |
| Molecular Weight | 437.45 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | [2-acetyloxy-4-[[2-(4-butoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] acetate |
| SMILES | CCCCOc1ccc(C2=NC(=Cc3ccc(OC(C)=O)c(OC(C)=O)c3)C(=O)O2)cc1 |
| InChI | InChI=1S/C24H23NO7/c1-4-5-12-29-19-9-7-18(8-10-19)23-25-20(24(28)32-23)13-17-6-11-21(30-15(2)26)22(14-17)31-16(3)27/h6-11,13-14H,4-5,12H2,1-3H3 |
| InChIKey | SDVSSSOIXYEVHT-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 100.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.45 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|