C27H23NO4 — CID 19668734
[4-[(Z)-[5-oxo-2-(4-propan-2-ylphenyl)-1,3-oxazol-4-ylidene]methyl]phenyl] 2-methylbenzoate (PubChem CID 19668734) has the molecular formula C27H23NO4 and a molecular weight of 425.48 g/mol. Its IUPAC name is [4-[(Z)-[5-oxo-2-(4-propan-2-ylphenyl)-1,3-oxazol-4-ylidene]methyl]phenyl] 2-methylbenzoate.
| Compound Name | [4-[(Z)-[5-oxo-2-(4-propan-2-ylphenyl)-1,3-oxazol-4-ylidene]methyl]phenyl] 2-methylbenzoate |
|---|---|
| PubChem CID | 19668734 |
| Molecular Formula | C27H23NO4 |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | [4-[(Z)-[5-oxo-2-(4-propan-2-ylphenyl)-1,3-oxazol-4-ylidene]methyl]phenyl] 2-methylbenzoate |
| SMILES | Cc1ccccc1C(=O)Oc1ccc(/C=C2\N=C(c3ccc(C(C)C)cc3)OC2=O)cc1 |
| InChI | InChI=1S/C27H23NO4/c1-17(2)20-10-12-21(13-11-20)25-28-24(27(30)32-25)16-19-8-14-22(15-9-19)31-26(29)23-7-5-4-6-18(23)3/h4-17H,1-3H3/b24-16- |
| InChIKey | DCTRSVVKDZTNCH-JLPGSUDCSA-N |
| XLogP | 5.68 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|