C23H12Cl3NO4 — CID 19672998
[4-[(Z)-[2-(3,4-dichlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 2-chlorobenzoate (PubChem CID 19672998) has the molecular formula C23H12Cl3NO4 and a molecular weight of 472.71 g/mol. Its IUPAC name is [4-[(Z)-[2-(3,4-dichlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 2-chlorobenzoate.
| Compound Name | [4-[(Z)-[2-(3,4-dichlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 2-chlorobenzoate |
|---|---|
| PubChem CID | 19672998 |
| Molecular Formula | C23H12Cl3NO4 |
| Molecular Weight | 472.71 g/mol |
| Exact Mass | 470.98 |
| IUPAC Name | [4-[(Z)-[2-(3,4-dichlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 2-chlorobenzoate |
| SMILES | O=C1OC(c2ccc(Cl)c(Cl)c2)=N/C1=C\c1ccc(OC(=O)c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C23H12Cl3NO4/c24-17-4-2-1-3-16(17)22(28)30-15-8-5-13(6-9-15)11-20-23(29)31-21(27-20)14-7-10-18(25)19(26)12-14/h1-12H/b20-11- |
| InChIKey | NOMRVVLXTBCDAL-JAIQZWGSSA-N |
| XLogP | 6.21 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.71 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|