C22H13Cl2NO3 — CID 50990705
(4E)-4-[[4-(3,4-dichlorophenoxy)phenyl]methylidene]-2-phenyl-1,3-oxazol-5-one (PubChem CID 50990705) has the molecular formula C22H13Cl2NO3 and a molecular weight of 410.26 g/mol. Its IUPAC name is (4E)-4-[[4-(3,4-dichlorophenoxy)phenyl]methylidene]-2-phenyl-1,3-oxazol-5-one.
| Compound Name | (4E)-4-[[4-(3,4-dichlorophenoxy)phenyl]methylidene]-2-phenyl-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 50990705 |
| Molecular Formula | C22H13Cl2NO3 |
| Molecular Weight | 410.26 g/mol |
| Exact Mass | 409.03 |
| IUPAC Name | (4E)-4-[[4-(3,4-dichlorophenoxy)phenyl]methylidene]-2-phenyl-1,3-oxazol-5-one |
| SMILES | O=C1OC(c2ccccc2)=N/C1=C/c1ccc(Oc2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C22H13Cl2NO3/c23-18-11-10-17(13-19(18)24)27-16-8-6-14(7-9-16)12-20-22(26)28-21(25-20)15-4-2-1-3-5-15/h1-13H/b20-12+ |
| InChIKey | ADPNZQKYVCZNGB-UDWIEESQSA-N |
| XLogP | 6.13 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.26 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|