C16H12N2O2 — CID 71414757
4-[(4-aminophenyl)methylidene]-2-phenyl-1,3-oxazol-5-one (PubChem CID 71414757) has the molecular formula C16H12N2O2 and a molecular weight of 264.28 g/mol. Its IUPAC name is 4-[(4-aminophenyl)methylidene]-2-phenyl-1,3-oxazol-5-one.
| Compound Name | 4-[(4-aminophenyl)methylidene]-2-phenyl-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 71414757 |
| Molecular Formula | C16H12N2O2 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 4-[(4-aminophenyl)methylidene]-2-phenyl-1,3-oxazol-5-one |
| SMILES | Nc1ccc(C=C2N=C(c3ccccc3)OC2=O)cc1 |
| InChI | InChI=1S/C16H12N2O2/c17-13-8-6-11(7-9-13)10-14-16(19)20-15(18-14)12-4-2-1-3-5-12/h1-10H,17H2 |
| InChIKey | VRNQDHJNYABNSZ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|