C16H9Br2NO3 — CID 94849006
(4E)-4-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-2-phenyl-1,3-oxazol-5-one (PubChem CID 94849006) has the molecular formula C16H9Br2NO3 and a molecular weight of 423.06 g/mol. Its IUPAC name is (4E)-4-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-2-phenyl-1,3-oxazol-5-one.
| Compound Name | (4E)-4-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-2-phenyl-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 94849006 |
| Molecular Formula | C16H9Br2NO3 |
| Molecular Weight | 423.06 g/mol |
| Exact Mass | 420.89 |
| IUPAC Name | (4E)-4-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-2-phenyl-1,3-oxazol-5-one |
| SMILES | O=C1OC(c2ccccc2)=N/C1=C/c1cc(Br)c(O)c(Br)c1 |
| InChI | InChI=1S/C16H9Br2NO3/c17-11-6-9(7-12(18)14(11)20)8-13-16(21)22-15(19-13)10-4-2-1-3-5-10/h1-8,20H/b13-8+ |
| InChIKey | ZTGCZIZDLOXSJB-MDWZMJQESA-N |
| XLogP | 4.26 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.06 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|