C17H11Cl2NO2 — CID 6050333
(4Z)-4-[(2,3-dichlorophenyl)methylidene]-2-(3-methylphenyl)-1,3-oxazol-5-one (PubChem CID 6050333) has the molecular formula C17H11Cl2NO2 and a molecular weight of 332.19 g/mol. Its IUPAC name is (4Z)-4-[(2,3-dichlorophenyl)methylidene]-2-(3-methylphenyl)-1,3-oxazol-5-one.
| Compound Name | (4Z)-4-[(2,3-dichlorophenyl)methylidene]-2-(3-methylphenyl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 6050333 |
| Molecular Formula | C17H11Cl2NO2 |
| Molecular Weight | 332.19 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | (4Z)-4-[(2,3-dichlorophenyl)methylidene]-2-(3-methylphenyl)-1,3-oxazol-5-one |
| SMILES | Cc1cccc(C2=N/C(=C\c3cccc(Cl)c3Cl)C(=O)O2)c1 |
| InChI | InChI=1S/C17H11Cl2NO2/c1-10-4-2-6-12(8-10)16-20-14(17(21)22-16)9-11-5-3-7-13(18)15(11)19/h2-9H,1H3/b14-9- |
| InChIKey | QIMPOVZBFWCSQM-ZROIWOOFSA-N |
| XLogP | 4.65 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.19 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|