C20H12Cl2N2O3 — CID 6991627
(4E)-4-[(2,3-dichlorophenyl)methylidene]-2-(5-methyl-3-phenyl-1,2-oxazol-4-yl)-1,3-oxazol-5-one (PubChem CID 6991627) has the molecular formula C20H12Cl2N2O3 and a molecular weight of 399.23 g/mol. Its IUPAC name is (4E)-4-[(2,3-dichlorophenyl)methylidene]-2-(5-methyl-3-phenyl-1,2-oxazol-4-yl)-1,3-oxazol-5-one.
| Compound Name | (4E)-4-[(2,3-dichlorophenyl)methylidene]-2-(5-methyl-3-phenyl-1,2-oxazol-4-yl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 6991627 |
| Molecular Formula | C20H12Cl2N2O3 |
| Molecular Weight | 399.23 g/mol |
| Exact Mass | 398.02 |
| IUPAC Name | (4E)-4-[(2,3-dichlorophenyl)methylidene]-2-(5-methyl-3-phenyl-1,2-oxazol-4-yl)-1,3-oxazol-5-one |
| SMILES | Cc1onc(-c2ccccc2)c1C1=N/C(=C/c2cccc(Cl)c2Cl)C(=O)O1 |
| InChI | InChI=1S/C20H12Cl2N2O3/c1-11-16(18(24-27-11)12-6-3-2-4-7-12)19-23-15(20(25)26-19)10-13-8-5-9-14(21)17(13)22/h2-10H,1H3/b15-10+ |
| InChIKey | TUNHFNNGFISCRI-XNTDXEJSSA-N |
| XLogP | 5.30 |
| TPSA | 64.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.23 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|