C24H22N2O3 — CID 6372706
(4Z)-4-[(4-tert-butylphenyl)methylidene]-2-(5-methyl-3-phenyl-1,2-oxazol-4-yl)-1,3-oxazol-5-one (PubChem CID 6372706) has the molecular formula C24H22N2O3 and a molecular weight of 386.45 g/mol. Its IUPAC name is (4Z)-4-[(4-tert-butylphenyl)methylidene]-2-(5-methyl-3-phenyl-1,2-oxazol-4-yl)-1,3-oxazol-5-one.
| Compound Name | (4Z)-4-[(4-tert-butylphenyl)methylidene]-2-(5-methyl-3-phenyl-1,2-oxazol-4-yl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 6372706 |
| Molecular Formula | C24H22N2O3 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | (4Z)-4-[(4-tert-butylphenyl)methylidene]-2-(5-methyl-3-phenyl-1,2-oxazol-4-yl)-1,3-oxazol-5-one |
| SMILES | Cc1onc(-c2ccccc2)c1C1=N/C(=C\c2ccc(C(C)(C)C)cc2)C(=O)O1 |
| InChI | InChI=1S/C24H22N2O3/c1-15-20(21(26-29-15)17-8-6-5-7-9-17)22-25-19(23(27)28-22)14-16-10-12-18(13-11-16)24(2,3)4/h5-14H,1-4H3/b19-14- |
| InChIKey | UPCYTDIQRZROMC-RGEXLXHISA-N |
| XLogP | 5.29 |
| TPSA | 64.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|