C21H18NO4- — CID 2395365
4-[(Z)-[2-(4-tert-butylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]benzoate (PubChem CID 2395365) has the molecular formula C21H18NO4- and a molecular weight of 348.38 g/mol. Its IUPAC name is 4-[(Z)-[2-(4-tert-butylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]benzoate.
| Compound Name | 4-[(Z)-[2-(4-tert-butylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]benzoate |
|---|---|
| PubChem CID | 2395365 |
| Molecular Formula | C21H18NO4- |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | 4-[(Z)-[2-(4-tert-butylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]benzoate |
| SMILES | CC(C)(C)c1ccc(C2=N/C(=C\c3ccc(C(=O)[O-])cc3)C(=O)O2)cc1 |
| InChI | InChI=1S/C21H19NO4/c1-21(2,3)16-10-8-14(9-11-16)18-22-17(20(25)26-18)12-13-4-6-15(7-5-13)19(23)24/h4-12H,1-3H3,(H,23,24)/p-1/b17-12- |
| InChIKey | RREMZUKAHJITRP-ATVHPVEESA-M |
| XLogP | 2.69 |
| TPSA | 78.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|