C21H18F3NO2 — CID 2302510
(4Z)-2-(4-tert-butylphenyl)-4-[[3-(trifluoromethyl)phenyl]methylidene]-1,3-oxazol-5-one (PubChem CID 2302510) has the molecular formula C21H18F3NO2 and a molecular weight of 373.37 g/mol. Its IUPAC name is (4Z)-2-(4-tert-butylphenyl)-4-[[3-(trifluoromethyl)phenyl]methylidene]-1,3-oxazol-5-one.
| Compound Name | (4Z)-2-(4-tert-butylphenyl)-4-[[3-(trifluoromethyl)phenyl]methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 2302510 |
| Molecular Formula | C21H18F3NO2 |
| Molecular Weight | 373.37 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | (4Z)-2-(4-tert-butylphenyl)-4-[[3-(trifluoromethyl)phenyl]methylidene]-1,3-oxazol-5-one |
| SMILES | CC(C)(C)c1ccc(C2=N/C(=C\c3cccc(C(F)(F)F)c3)C(=O)O2)cc1 |
| InChI | InChI=1S/C21H18F3NO2/c1-20(2,3)15-9-7-14(8-10-15)18-25-17(19(26)27-18)12-13-5-4-6-16(11-13)21(22,23)24/h4-12H,1-3H3/b17-12- |
| InChIKey | RWROKZLDLLVASI-ATVHPVEESA-N |
| XLogP | 5.35 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.37 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|