C23H13ClF3NO2 — CID 18524134
(4E)-2-(4-chlorophenyl)-4-[[4-[4-(trifluoromethyl)phenyl]phenyl]methylidene]-1,3-oxazol-5-one (PubChem CID 18524134) has the molecular formula C23H13ClF3NO2 and a molecular weight of 427.81 g/mol. Its IUPAC name is (4E)-2-(4-chlorophenyl)-4-[[4-[4-(trifluoromethyl)phenyl]phenyl]methylidene]-1,3-oxazol-5-one.
| Compound Name | (4E)-2-(4-chlorophenyl)-4-[[4-[4-(trifluoromethyl)phenyl]phenyl]methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 18524134 |
| Molecular Formula | C23H13ClF3NO2 |
| Molecular Weight | 427.81 g/mol |
| Exact Mass | 427.06 |
| IUPAC Name | (4E)-2-(4-chlorophenyl)-4-[[4-[4-(trifluoromethyl)phenyl]phenyl]methylidene]-1,3-oxazol-5-one |
| SMILES | O=C1OC(c2ccc(Cl)cc2)=N/C1=C/c1ccc(-c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C23H13ClF3NO2/c24-19-11-7-17(8-12-19)21-28-20(22(29)30-21)13-14-1-3-15(4-2-14)16-5-9-18(10-6-16)23(25,26)27/h1-13H/b20-13+ |
| InChIKey | AEJJOPFHEVQHSC-DEDYPNTBSA-N |
| XLogP | 6.37 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.81 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|