C17H9ClF3NO3 — CID 6086637
(4Z)-2-(4-chlorophenyl)-4-[[4-(trifluoromethoxy)phenyl]methylidene]-1,3-oxazol-5-one (PubChem CID 6086637) has the molecular formula C17H9ClF3NO3 and a molecular weight of 367.71 g/mol. Its IUPAC name is (4Z)-2-(4-chlorophenyl)-4-[[4-(trifluoromethoxy)phenyl]methylidene]-1,3-oxazol-5-one.
| Compound Name | (4Z)-2-(4-chlorophenyl)-4-[[4-(trifluoromethoxy)phenyl]methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 6086637 |
| Molecular Formula | C17H9ClF3NO3 |
| Molecular Weight | 367.71 g/mol |
| Exact Mass | 367.02 |
| IUPAC Name | (4Z)-2-(4-chlorophenyl)-4-[[4-(trifluoromethoxy)phenyl]methylidene]-1,3-oxazol-5-one |
| SMILES | O=C1OC(c2ccc(Cl)cc2)=N/C1=C\c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C17H9ClF3NO3/c18-12-5-3-11(4-6-12)15-22-14(16(23)24-15)9-10-1-7-13(8-2-10)25-17(19,20)21/h1-9H/b14-9- |
| InChIKey | RFZRBGAJMBFBOO-ZROIWOOFSA-N |
| XLogP | 4.58 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.71 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|