C27H23F3N2O4 — CID 66811912
(4Z)-2-[4-[2-[4-(dimethylamino)phenyl]ethoxy]phenyl]-4-[[4-(trifluoromethoxy)phenyl]methylidene]-1,3-oxazol-5-one (PubChem CID 66811912) has the molecular formula C27H23F3N2O4 and a molecular weight of 496.49 g/mol. Its IUPAC name is (4Z)-2-[4-[2-[4-(dimethylamino)phenyl]ethoxy]phenyl]-4-[[4-(trifluoromethoxy)phenyl]methylidene]-1,3-oxazol-5-one.
| Compound Name | (4Z)-2-[4-[2-[4-(dimethylamino)phenyl]ethoxy]phenyl]-4-[[4-(trifluoromethoxy)phenyl]methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 66811912 |
| Molecular Formula | C27H23F3N2O4 |
| Molecular Weight | 496.49 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | (4Z)-2-[4-[2-[4-(dimethylamino)phenyl]ethoxy]phenyl]-4-[[4-(trifluoromethoxy)phenyl]methylidene]-1,3-oxazol-5-one |
| SMILES | CN(C)c1ccc(CCOc2ccc(C3=N/C(=C\c4ccc(OC(F)(F)F)cc4)C(=O)O3)cc2)cc1 |
| InChI | InChI=1S/C27H23F3N2O4/c1-32(2)21-9-3-18(4-10-21)15-16-34-22-13-7-20(8-14-22)25-31-24(26(33)35-25)17-19-5-11-23(12-6-19)36-27(28,29)30/h3-14,17H,15-16H2,1-2H3/b24-17- |
| InChIKey | OYBGWPXTHGKUIV-ULJHMMPZSA-N |
| XLogP | 5.62 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.49 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|