C18H12NO5- — CID 6924900
4-[(E)-[2-(2-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]benzoate (PubChem CID 6924900) has the molecular formula C18H12NO5- and a molecular weight of 322.30 g/mol. Its IUPAC name is 4-[(E)-[2-(2-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]benzoate.
| Compound Name | 4-[(E)-[2-(2-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]benzoate |
|---|---|
| PubChem CID | 6924900 |
| Molecular Formula | C18H12NO5- |
| Molecular Weight | 322.30 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | 4-[(E)-[2-(2-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]benzoate |
| SMILES | COc1ccccc1C1=N/C(=C/c2ccc(C(=O)[O-])cc2)C(=O)O1 |
| InChI | InChI=1S/C18H13NO5/c1-23-15-5-3-2-4-13(15)16-19-14(18(22)24-16)10-11-6-8-12(9-7-11)17(20)21/h2-10H,1H3,(H,20,21)/p-1/b14-10+ |
| InChIKey | SFJJENAUZSADPI-GXDHUFHOSA-M |
| XLogP | 1.40 |
| TPSA | 88.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.30 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|