C18H13F2NO4 — CID 9313747
(4Z)-2-[2-(difluoromethoxy)phenyl]-4-[(4-methoxyphenyl)methylidene]-1,3-oxazol-5-one (PubChem CID 9313747) has the molecular formula C18H13F2NO4 and a molecular weight of 345.30 g/mol. Its IUPAC name is (4Z)-2-[2-(difluoromethoxy)phenyl]-4-[(4-methoxyphenyl)methylidene]-1,3-oxazol-5-one.
| Compound Name | (4Z)-2-[2-(difluoromethoxy)phenyl]-4-[(4-methoxyphenyl)methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 9313747 |
| Molecular Formula | C18H13F2NO4 |
| Molecular Weight | 345.30 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | (4Z)-2-[2-(difluoromethoxy)phenyl]-4-[(4-methoxyphenyl)methylidene]-1,3-oxazol-5-one |
| SMILES | COc1ccc(/C=C2\N=C(c3ccccc3OC(F)F)OC2=O)cc1 |
| InChI | InChI=1S/C18H13F2NO4/c1-23-12-8-6-11(7-9-12)10-14-17(22)25-16(21-14)13-4-2-3-5-15(13)24-18(19)20/h2-10,18H,1H3/b14-10- |
| InChIKey | VFPSINBTMVSRAD-UVTDQMKNSA-N |
| XLogP | 3.64 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.30 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|