C19H13F2NO5 — CID 9052349
methyl 2-[(Z)-[2-[2-(difluoromethoxy)phenyl]-5-oxo-1,3-oxazol-4-ylidene]methyl]benzoate (PubChem CID 9052349) has the molecular formula C19H13F2NO5 and a molecular weight of 373.31 g/mol. Its IUPAC name is methyl 2-[(Z)-[2-[2-(difluoromethoxy)phenyl]-5-oxo-1,3-oxazol-4-ylidene]methyl]benzoate.
| Compound Name | methyl 2-[(Z)-[2-[2-(difluoromethoxy)phenyl]-5-oxo-1,3-oxazol-4-ylidene]methyl]benzoate |
|---|---|
| PubChem CID | 9052349 |
| Molecular Formula | C19H13F2NO5 |
| Molecular Weight | 373.31 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | methyl 2-[(Z)-[2-[2-(difluoromethoxy)phenyl]-5-oxo-1,3-oxazol-4-ylidene]methyl]benzoate |
| SMILES | COC(=O)c1ccccc1/C=C1\N=C(c2ccccc2OC(F)F)OC1=O |
| InChI | InChI=1S/C19H13F2NO5/c1-25-17(23)12-7-3-2-6-11(12)10-14-18(24)27-16(22-14)13-8-4-5-9-15(13)26-19(20)21/h2-10,19H,1H3/b14-10- |
| InChIKey | ZPTWZNVUQORPFA-UVTDQMKNSA-N |
| XLogP | 3.42 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.31 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|