C20H11Cl2N3O5 — CID 139235658
(4E)-2-[5-(2,6-dichlorophenyl)-3-methyl-1,2-oxazol-4-yl]-4-[(2-nitrophenyl)methylidene]-1,3-oxazol-5-one (PubChem CID 139235658) has the molecular formula C20H11Cl2N3O5 and a molecular weight of 444.23 g/mol. Its IUPAC name is (4E)-2-[5-(2,6-dichlorophenyl)-3-methyl-1,2-oxazol-4-yl]-4-[(2-nitrophenyl)methylidene]-1,3-oxazol-5-one.
| Compound Name | (4E)-2-[5-(2,6-dichlorophenyl)-3-methyl-1,2-oxazol-4-yl]-4-[(2-nitrophenyl)methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 139235658 |
| Molecular Formula | C20H11Cl2N3O5 |
| Molecular Weight | 444.23 g/mol |
| Exact Mass | 443.01 |
| IUPAC Name | (4E)-2-[5-(2,6-dichlorophenyl)-3-methyl-1,2-oxazol-4-yl]-4-[(2-nitrophenyl)methylidene]-1,3-oxazol-5-one |
| SMILES | Cc1noc(-c2c(Cl)cccc2Cl)c1C1=N/C(=C/c2ccccc2[N+](=O)[O-])C(=O)O1 |
| InChI | InChI=1S/C20H11Cl2N3O5/c1-10-16(18(30-24-10)17-12(21)6-4-7-13(17)22)19-23-14(20(26)29-19)9-11-5-2-3-8-15(11)25(27)28/h2-9H,1H3/b14-9+ |
| InChIKey | ODBUWHQJNHRHJD-NTEUORMPSA-N |
| XLogP | 5.21 |
| TPSA | 107.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.23 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|