C17H11BrFNO2 — CID 6067183
(4Z)-4-[(5-bromo-2-fluorophenyl)methylidene]-2-(3-methylphenyl)-1,3-oxazol-5-one (PubChem CID 6067183) has the molecular formula C17H11BrFNO2 and a molecular weight of 360.18 g/mol. Its IUPAC name is (4Z)-4-[(5-bromo-2-fluorophenyl)methylidene]-2-(3-methylphenyl)-1,3-oxazol-5-one.
| Compound Name | (4Z)-4-[(5-bromo-2-fluorophenyl)methylidene]-2-(3-methylphenyl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 6067183 |
| Molecular Formula | C17H11BrFNO2 |
| Molecular Weight | 360.18 g/mol |
| Exact Mass | 359.00 |
| IUPAC Name | (4Z)-4-[(5-bromo-2-fluorophenyl)methylidene]-2-(3-methylphenyl)-1,3-oxazol-5-one |
| SMILES | Cc1cccc(C2=N/C(=C\c3cc(Br)ccc3F)C(=O)O2)c1 |
| InChI | InChI=1S/C17H11BrFNO2/c1-10-3-2-4-11(7-10)16-20-15(17(21)22-16)9-12-8-13(18)5-6-14(12)19/h2-9H,1H3/b15-9- |
| InChIKey | YDFADBNSISOREP-DHDCSXOGSA-N |
| XLogP | 4.24 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.18 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|