C18H14FNO2 — CID 2875285
4-[(2,5-dimethylphenyl)methylidene]-2-(3-fluorophenyl)-1,3-oxazol-5-one (PubChem CID 2875285) has the molecular formula C18H14FNO2 and a molecular weight of 295.31 g/mol. Its IUPAC name is 4-[(2,5-dimethylphenyl)methylidene]-2-(3-fluorophenyl)-1,3-oxazol-5-one.
| Compound Name | 4-[(2,5-dimethylphenyl)methylidene]-2-(3-fluorophenyl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 2875285 |
| Molecular Formula | C18H14FNO2 |
| Molecular Weight | 295.31 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 4-[(2,5-dimethylphenyl)methylidene]-2-(3-fluorophenyl)-1,3-oxazol-5-one |
| SMILES | Cc1ccc(C)c(C=C2N=C(c3cccc(F)c3)OC2=O)c1 |
| InChI | InChI=1S/C18H14FNO2/c1-11-6-7-12(2)14(8-11)10-16-18(21)22-17(20-16)13-4-3-5-15(19)9-13/h3-10H,1-2H3 |
| InChIKey | QPRPRBASVJQBFV-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.31 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|