C17H12FN3O2 — CID 9313085
4-[(E)-[2-(3-fluorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-1,5-dimethylpyrrole-2-carbonitrile (PubChem CID 9313085) has the molecular formula C17H12FN3O2 and a molecular weight of 309.30 g/mol. Its IUPAC name is 4-[(E)-[2-(3-fluorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-1,5-dimethylpyrrole-2-carbonitrile.
| Compound Name | 4-[(E)-[2-(3-fluorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-1,5-dimethylpyrrole-2-carbonitrile |
|---|---|
| PubChem CID | 9313085 |
| Molecular Formula | C17H12FN3O2 |
| Molecular Weight | 309.30 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | 4-[(E)-[2-(3-fluorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-1,5-dimethylpyrrole-2-carbonitrile |
| SMILES | Cc1c(/C=C2/N=C(c3cccc(F)c3)OC2=O)cc(C#N)n1C |
| InChI | InChI=1S/C17H12FN3O2/c1-10-12(7-14(9-19)21(10)2)8-15-17(22)23-16(20-15)11-4-3-5-13(18)6-11/h3-8H,1-2H3/b15-8+ |
| InChIKey | CYLBKLJKGLTIQT-OVCLIPMQSA-N |
| XLogP | 2.69 |
| TPSA | 67.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.30 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|