C18H14BrNO5S — CID 2935428
[4-bromo-2-[[2-(3-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] methanesulfonate (PubChem CID 2935428) has the molecular formula C18H14BrNO5S and a molecular weight of 436.28 g/mol. Its IUPAC name is [4-bromo-2-[[2-(3-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] methanesulfonate.
| Compound Name | [4-bromo-2-[[2-(3-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 2935428 |
| Molecular Formula | C18H14BrNO5S |
| Molecular Weight | 436.28 g/mol |
| Exact Mass | 434.98 |
| IUPAC Name | [4-bromo-2-[[2-(3-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] methanesulfonate |
| SMILES | Cc1cccc(C2=NC(=Cc3cc(Br)ccc3OS(C)(=O)=O)C(=O)O2)c1 |
| InChI | InChI=1S/C18H14BrNO5S/c1-11-4-3-5-12(8-11)17-20-15(18(21)24-17)10-13-9-14(19)6-7-16(13)25-26(2,22)23/h3-10H,1-2H3 |
| InChIKey | UWNSYLFKACNVGS-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 82.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.28 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|