C25H17NO2 — CID 20834647
(4E)-4-(anthracen-9-ylmethylidene)-2-(3-methylphenyl)-1,3-oxazol-5-one (PubChem CID 20834647) has the molecular formula C25H17NO2 and a molecular weight of 363.42 g/mol. Its IUPAC name is (4E)-4-(anthracen-9-ylmethylidene)-2-(3-methylphenyl)-1,3-oxazol-5-one.
| Compound Name | (4E)-4-(anthracen-9-ylmethylidene)-2-(3-methylphenyl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 20834647 |
| Molecular Formula | C25H17NO2 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | (4E)-4-(anthracen-9-ylmethylidene)-2-(3-methylphenyl)-1,3-oxazol-5-one |
| SMILES | Cc1cccc(C2=N/C(=C/c3c4ccccc4cc4ccccc34)C(=O)O2)c1 |
| InChI | InChI=1S/C25H17NO2/c1-16-7-6-10-19(13-16)24-26-23(25(27)28-24)15-22-20-11-4-2-8-17(20)14-18-9-3-5-12-21(18)22/h2-15H,1H3/b23-15+ |
| InChIKey | QMHJZDCILPUMFN-HZHRSRAPSA-N |
| XLogP | 5.65 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|