C15H17NO2 — CID 155424413
(4Z)-2-(3-methylphenyl)-4-pentylidene-1,3-oxazol-5-one (PubChem CID 155424413) has the molecular formula C15H17NO2 and a molecular weight of 243.31 g/mol. Its IUPAC name is (4Z)-2-(3-methylphenyl)-4-pentylidene-1,3-oxazol-5-one.
| Compound Name | (4Z)-2-(3-methylphenyl)-4-pentylidene-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 155424413 |
| Molecular Formula | C15H17NO2 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | (4Z)-2-(3-methylphenyl)-4-pentylidene-1,3-oxazol-5-one |
| SMILES | CCCC/C=C1\N=C(c2cccc(C)c2)OC1=O |
| InChI | InChI=1S/C15H17NO2/c1-3-4-5-9-13-15(17)18-14(16-13)12-8-6-7-11(2)10-12/h6-10H,3-5H2,1-2H3/b13-9- |
| InChIKey | OLQQVUXOVJGSDW-LCYFTJDESA-N |
| XLogP | 3.37 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|