C21H21NO4 — CID 108937529
(4Z)-2-(3,4-dimethoxyphenyl)-4-[(2,4,6-trimethylphenyl)methylidene]-1,3-oxazol-5-one (PubChem CID 108937529) has the molecular formula C21H21NO4 and a molecular weight of 351.40 g/mol. Its IUPAC name is (4Z)-2-(3,4-dimethoxyphenyl)-4-[(2,4,6-trimethylphenyl)methylidene]-1,3-oxazol-5-one.
| Compound Name | (4Z)-2-(3,4-dimethoxyphenyl)-4-[(2,4,6-trimethylphenyl)methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 108937529 |
| Molecular Formula | C21H21NO4 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | (4Z)-2-(3,4-dimethoxyphenyl)-4-[(2,4,6-trimethylphenyl)methylidene]-1,3-oxazol-5-one |
| SMILES | COc1ccc(C2=N/C(=C\c3c(C)cc(C)cc3C)C(=O)O2)cc1OC |
| InChI | InChI=1S/C21H21NO4/c1-12-8-13(2)16(14(3)9-12)11-17-21(23)26-20(22-17)15-6-7-18(24-4)19(10-15)25-5/h6-11H,1-5H3/b17-11- |
| InChIKey | AJBFSMCELQOVCN-BOPFTXTBSA-N |
| XLogP | 3.97 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|