C16H12BrNO3S — CID 7779117
(4Z)-4-[(4-bromothiophen-2-yl)methylidene]-2-(2-ethoxyphenyl)-1,3-oxazol-5-one (PubChem CID 7779117) has the molecular formula C16H12BrNO3S and a molecular weight of 378.25 g/mol. Its IUPAC name is (4Z)-4-[(4-bromothiophen-2-yl)methylidene]-2-(2-ethoxyphenyl)-1,3-oxazol-5-one.
| Compound Name | (4Z)-4-[(4-bromothiophen-2-yl)methylidene]-2-(2-ethoxyphenyl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 7779117 |
| Molecular Formula | C16H12BrNO3S |
| Molecular Weight | 378.25 g/mol |
| Exact Mass | 376.97 |
| IUPAC Name | (4Z)-4-[(4-bromothiophen-2-yl)methylidene]-2-(2-ethoxyphenyl)-1,3-oxazol-5-one |
| SMILES | CCOc1ccccc1C1=N/C(=C\c2cc(Br)cs2)C(=O)O1 |
| InChI | InChI=1S/C16H12BrNO3S/c1-2-20-14-6-4-3-5-12(14)15-18-13(16(19)21-15)8-11-7-10(17)9-22-11/h3-9H,2H2,1H3/b13-8- |
| InChIKey | POUOQRMVNZRBAC-JYRVWZFOSA-N |
| XLogP | 4.25 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.25 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|