C18H15BrN2O3S — CID 93030798
(4E)-2-(4-bromophenyl)-4-[(5-morpholin-4-ylthiophen-2-yl)methylidene]-1,3-oxazol-5-one (PubChem CID 93030798) has the molecular formula C18H15BrN2O3S and a molecular weight of 419.30 g/mol. Its IUPAC name is (4E)-2-(4-bromophenyl)-4-[(5-morpholin-4-ylthiophen-2-yl)methylidene]-1,3-oxazol-5-one.
| Compound Name | (4E)-2-(4-bromophenyl)-4-[(5-morpholin-4-ylthiophen-2-yl)methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 93030798 |
| Molecular Formula | C18H15BrN2O3S |
| Molecular Weight | 419.30 g/mol |
| Exact Mass | 418.00 |
| IUPAC Name | (4E)-2-(4-bromophenyl)-4-[(5-morpholin-4-ylthiophen-2-yl)methylidene]-1,3-oxazol-5-one |
| SMILES | O=C1OC(c2ccc(Br)cc2)=N/C1=C/c1ccc(N2CCOCC2)s1 |
| InChI | InChI=1S/C18H15BrN2O3S/c19-13-3-1-12(2-4-13)17-20-15(18(22)24-17)11-14-5-6-16(25-14)21-7-9-23-10-8-21/h1-6,11H,7-10H2/b15-11+ |
| InChIKey | ZLKVAIFVNXLSQC-RVDMUPIBSA-N |
| XLogP | 3.69 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.30 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|