C17H20N2O6 — CID 4201220
4-(morpholin-4-ylmethylidene)-2-(3,4,5-trimethoxyphenyl)-1,3-oxazol-5-one (PubChem CID 4201220) has the molecular formula C17H20N2O6 and a molecular weight of 348.36 g/mol. Its IUPAC name is 4-(morpholin-4-ylmethylidene)-2-(3,4,5-trimethoxyphenyl)-1,3-oxazol-5-one.
| Compound Name | 4-(morpholin-4-ylmethylidene)-2-(3,4,5-trimethoxyphenyl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 4201220 |
| Molecular Formula | C17H20N2O6 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 4-(morpholin-4-ylmethylidene)-2-(3,4,5-trimethoxyphenyl)-1,3-oxazol-5-one |
| SMILES | COc1cc(C2=NC(=CN3CCOCC3)C(=O)O2)cc(OC)c1OC |
| InChI | InChI=1S/C17H20N2O6/c1-21-13-8-11(9-14(22-2)15(13)23-3)16-18-12(17(20)25-16)10-19-4-6-24-7-5-19/h8-10H,4-7H2,1-3H3 |
| InChIKey | OCNUJIUAQJCBCP-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 78.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|