C19H15BrFNO5 — CID 92931425
(4E)-4-[(3-bromo-4-fluorophenyl)methylidene]-2-(3,4,5-trimethoxyphenyl)-1,3-oxazol-5-one (PubChem CID 92931425) has the molecular formula C19H15BrFNO5 and a molecular weight of 436.23 g/mol. Its IUPAC name is (4E)-4-[(3-bromo-4-fluorophenyl)methylidene]-2-(3,4,5-trimethoxyphenyl)-1,3-oxazol-5-one.
| Compound Name | (4E)-4-[(3-bromo-4-fluorophenyl)methylidene]-2-(3,4,5-trimethoxyphenyl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 92931425 |
| Molecular Formula | C19H15BrFNO5 |
| Molecular Weight | 436.23 g/mol |
| Exact Mass | 435.01 |
| IUPAC Name | (4E)-4-[(3-bromo-4-fluorophenyl)methylidene]-2-(3,4,5-trimethoxyphenyl)-1,3-oxazol-5-one |
| SMILES | COc1cc(C2=N/C(=C/c3ccc(F)c(Br)c3)C(=O)O2)cc(OC)c1OC |
| InChI | InChI=1S/C19H15BrFNO5/c1-24-15-8-11(9-16(25-2)17(15)26-3)18-22-14(19(23)27-18)7-10-4-5-13(21)12(20)6-10/h4-9H,1-3H3/b14-7+ |
| InChIKey | MLRDKXLFDLSGTL-VGOFMYFVSA-N |
| XLogP | 3.96 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.23 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|