C24H17Cl2NO4S — CID 18808871
methyl 2-[[5-(3,5-dichlorophenyl)-2-methylfuran-3-carbonyl]amino]-4-phenylthiophene-3-carboxylate (PubChem CID 18808871) has the molecular formula C24H17Cl2NO4S and a molecular weight of 486.38 g/mol. Its IUPAC name is methyl 2-[[5-(3,5-dichlorophenyl)-2-methylfuran-3-carbonyl]amino]-4-phenylthiophene-3-carboxylate.
| Compound Name | methyl 2-[[5-(3,5-dichlorophenyl)-2-methylfuran-3-carbonyl]amino]-4-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 18808871 |
| Molecular Formula | C24H17Cl2NO4S |
| Molecular Weight | 486.38 g/mol |
| Exact Mass | 485.03 |
| IUPAC Name | methyl 2-[[5-(3,5-dichlorophenyl)-2-methylfuran-3-carbonyl]amino]-4-phenylthiophene-3-carboxylate |
| SMILES | COC(=O)c1c(-c2ccccc2)csc1NC(=O)c1cc(-c2cc(Cl)cc(Cl)c2)oc1C |
| InChI | InChI=1S/C24H17Cl2NO4S/c1-13-18(11-20(31-13)15-8-16(25)10-17(26)9-15)22(28)27-23-21(24(29)30-2)19(12-32-23)14-6-4-3-5-7-14/h3-12H,1-2H3,(H,27,28) |
| InChIKey | KIPIGPIFHKFBAP-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.38 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|