C8H9ClO5S — CID 62086161
methyl 5-(chlorosulfonylmethyl)-2-methylfuran-3-carboxylate (PubChem CID 62086161) has the molecular formula C8H9ClO5S and a molecular weight of 252.67 g/mol. Its IUPAC name is methyl 5-(chlorosulfonylmethyl)-2-methylfuran-3-carboxylate.
| Compound Name | methyl 5-(chlorosulfonylmethyl)-2-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 62086161 |
| Molecular Formula | C8H9ClO5S |
| Molecular Weight | 252.67 g/mol |
| Exact Mass | 251.99 |
| IUPAC Name | methyl 5-(chlorosulfonylmethyl)-2-methylfuran-3-carboxylate |
| SMILES | COC(=O)c1cc(CS(=O)(=O)Cl)oc1C |
| InChI | InChI=1S/C8H9ClO5S/c1-5-7(8(10)13-2)3-6(14-5)4-15(9,11)12/h3H,4H2,1-2H3 |
| InChIKey | SNVVRXSFAXVTAG-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 73.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.67 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |