C11H17NO4 — CID 114985528
methyl 5-[[[(2R)-1-hydroxypropan-2-yl]amino]methyl]-2-methylfuran-3-carboxylate (PubChem CID 114985528) has the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. Its IUPAC name is methyl 5-[[[(2R)-1-hydroxypropan-2-yl]amino]methyl]-2-methylfuran-3-carboxylate.
| Compound Name | methyl 5-[[[(2R)-1-hydroxypropan-2-yl]amino]methyl]-2-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 114985528 |
| Molecular Formula | C11H17NO4 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | methyl 5-[[[(2R)-1-hydroxypropan-2-yl]amino]methyl]-2-methylfuran-3-carboxylate |
| SMILES | COC(=O)c1cc(CN[C@H](C)CO)oc1C |
| InChI | InChI=1S/C11H17NO4/c1-7(6-13)12-5-9-4-10(8(2)16-9)11(14)15-3/h4,7,12-13H,5-6H2,1-3H3/t7-/m1/s1 |
| InChIKey | PGQBFUKTUXATRF-SSDOTTSWSA-N |
| XLogP | 0.85 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |