C14H17NO4 — CID 81400076
methyl 5-[[[(1R)-1-(furan-2-yl)ethyl]amino]methyl]-2-methylfuran-3-carboxylate (PubChem CID 81400076) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is methyl 5-[[[(1R)-1-(furan-2-yl)ethyl]amino]methyl]-2-methylfuran-3-carboxylate.
| Compound Name | methyl 5-[[[(1R)-1-(furan-2-yl)ethyl]amino]methyl]-2-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 81400076 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | methyl 5-[[[(1R)-1-(furan-2-yl)ethyl]amino]methyl]-2-methylfuran-3-carboxylate |
| SMILES | COC(=O)c1cc(CN[C@H](C)c2ccco2)oc1C |
| InChI | InChI=1S/C14H17NO4/c1-9(13-5-4-6-18-13)15-8-11-7-12(10(2)19-11)14(16)17-3/h4-7,9,15H,8H2,1-3H3/t9-/m1/s1 |
| InChIKey | ANWBAVWROVYPBQ-SECBINFHSA-N |
| XLogP | 2.82 |
| TPSA | 64.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |