C16H18ClNO3 — CID 81375393
methyl 5-[[[(1R)-1-(2-chlorophenyl)ethyl]amino]methyl]-2-methylfuran-3-carboxylate (PubChem CID 81375393) has the molecular formula C16H18ClNO3 and a molecular weight of 307.78 g/mol. Its IUPAC name is methyl 5-[[[(1R)-1-(2-chlorophenyl)ethyl]amino]methyl]-2-methylfuran-3-carboxylate.
| Compound Name | methyl 5-[[[(1R)-1-(2-chlorophenyl)ethyl]amino]methyl]-2-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 81375393 |
| Molecular Formula | C16H18ClNO3 |
| Molecular Weight | 307.78 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | methyl 5-[[[(1R)-1-(2-chlorophenyl)ethyl]amino]methyl]-2-methylfuran-3-carboxylate |
| SMILES | COC(=O)c1cc(CN[C@H](C)c2ccccc2Cl)oc1C |
| InChI | InChI=1S/C16H18ClNO3/c1-10(13-6-4-5-7-15(13)17)18-9-12-8-14(11(2)21-12)16(19)20-3/h4-8,10,18H,9H2,1-3H3/t10-/m1/s1 |
| InChIKey | CJPGHCQVWMHQOC-SNVBAGLBSA-N |
| XLogP | 3.88 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.78 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |