C15H24N2O4 — CID 43779505
methyl 2-methyl-5-[(1-morpholin-4-ylpropan-2-ylamino)methyl]furan-3-carboxylate (PubChem CID 43779505) has the molecular formula C15H24N2O4 and a molecular weight of 296.37 g/mol. Its IUPAC name is methyl 2-methyl-5-[(1-morpholin-4-ylpropan-2-ylamino)methyl]furan-3-carboxylate.
| Compound Name | methyl 2-methyl-5-[(1-morpholin-4-ylpropan-2-ylamino)methyl]furan-3-carboxylate |
|---|---|
| PubChem CID | 43779505 |
| Molecular Formula | C15H24N2O4 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | methyl 2-methyl-5-[(1-morpholin-4-ylpropan-2-ylamino)methyl]furan-3-carboxylate |
| SMILES | COC(=O)c1cc(CNC(C)CN2CCOCC2)oc1C |
| InChI | InChI=1S/C15H24N2O4/c1-11(10-17-4-6-20-7-5-17)16-9-13-8-14(12(2)21-13)15(18)19-3/h8,11,16H,4-7,9-10H2,1-3H3 |
| InChIKey | VZRKMHRYJWGNDQ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 63.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |