About methyl 5-[(4-bromo-2,6-dichloroanilino)methyl]-2-methylfuran-3-carboxylate
methyl 5-[(4-bromo-2,6-dichloroanilino)methyl]-2-methylfuran-3-carboxylate (PubChem CID 43773757) has the molecular formula C14H12BrCl2NO3
and a molecular weight of 393.06 g/mol. Its IUPAC name is methyl 5-[(4-bromo-2,6-dichloroanilino)methyl]-2-methylfuran-3-carboxylate.
Molecular Properties
| Compound Name | methyl 5-[(4-bromo-2,6-dichloroanilino)methyl]-2-methylfuran-3-carboxylate |
| PubChem CID | 43773757 |
| Molecular Formula | C14H12BrCl2NO3 |
| Molecular Weight | 393.06 g/mol |
| Exact Mass | 390.94 |
| IUPAC Name | methyl 5-[(4-bromo-2,6-dichloroanilino)methyl]-2-methylfuran-3-carboxylate |
| SMILES | COC(=O)c1cc(CNc2c(Cl)cc(Br)cc2Cl)oc1C |
| InChI | InChI=1S/C14H12BrCl2NO3/c1-7-10(14(19)20-2)5-9(21-7)6-18-13-11(16)3-8(15)4-12(13)17/h3-5,18H,6H2,1-2H3 |
| InChIKey | MTXZBQHHNKEWTA-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 393.06 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 5-[(4-bromo-2,6-dichloroanilino)methyl]-2-methylfuran-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-[(4-bromo-2,6-dichloroanilino)methyl]-2-methylfuran-3-carboxylate?
The IUPAC name of methyl 5-[(4-bromo-2,6-dichloroanilino)methyl]-2-methylfuran-3-carboxylate (CID 43773757) is methyl 5-[(4-bromo-2,6-dichloroanilino)methyl]-2-methylfuran-3-carboxylate.
What is the SMILES notation for methyl 5-[(4-bromo-2,6-dichloroanilino)methyl]-2-methylfuran-3-carboxylate?
The canonical SMILES for methyl 5-[(4-bromo-2,6-dichloroanilino)methyl]-2-methylfuran-3-carboxylate is COC(=O)c1cc(CNc2c(Cl)cc(Br)cc2Cl)oc1C.
What is the InChIKey of methyl 5-[(4-bromo-2,6-dichloroanilino)methyl]-2-methylfuran-3-carboxylate?
The InChIKey is MTXZBQHHNKEWTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12BrCl2NO3/c1-7-10(14(19)20-2)5-9(21-7)6-18-13-11(16)3-8(15)4-12(13)17/h3-5,18H,6H2,1-2H3.
What are the key properties of methyl 5-[(4-bromo-2,6-dichloroanilino)methyl]-2-methylfuran-3-carboxylate?
methyl 5-[(4-bromo-2,6-dichloroanilino)methyl]-2-methylfuran-3-carboxylate has a molecular weight of 393.06 g/mol, XLogP of 5.06, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-[(4-bromo-2,6-dichloroanilino)methyl]-2-methylfuran-3-carboxylate is sourced from PubChem (CID 43773757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).