C14H14INO3 — CID 43222423
methyl 5-[(3-iodoanilino)methyl]-2-methylfuran-3-carboxylate (PubChem CID 43222423) has the molecular formula C14H14INO3 and a molecular weight of 371.17 g/mol. Its IUPAC name is methyl 5-[(3-iodoanilino)methyl]-2-methylfuran-3-carboxylate.
| Compound Name | methyl 5-[(3-iodoanilino)methyl]-2-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 43222423 |
| Molecular Formula | C14H14INO3 |
| Molecular Weight | 371.17 g/mol |
| Exact Mass | 371.00 |
| IUPAC Name | methyl 5-[(3-iodoanilino)methyl]-2-methylfuran-3-carboxylate |
| SMILES | COC(=O)c1cc(CNc2cccc(I)c2)oc1C |
| InChI | InChI=1S/C14H14INO3/c1-9-13(14(17)18-2)7-12(19-9)8-16-11-5-3-4-10(15)6-11/h3-7,16H,8H2,1-2H3 |
| InChIKey | GHHTVEZYRHKWQD-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.17 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|