C13H13FN2O3 — CID 75483063
methyl 5-[[(3-fluoro-2-pyridinyl)amino]methyl]-2-methylfuran-3-carboxylate (PubChem CID 75483063) has the molecular formula C13H13FN2O3 and a molecular weight of 264.26 g/mol. Its IUPAC name is methyl 5-[[(3-fluoro-2-pyridinyl)amino]methyl]-2-methylfuran-3-carboxylate.
| Compound Name | methyl 5-[[(3-fluoro-2-pyridinyl)amino]methyl]-2-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 75483063 |
| Molecular Formula | C13H13FN2O3 |
| Molecular Weight | 264.26 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | methyl 5-[[(3-fluoro-2-pyridinyl)amino]methyl]-2-methylfuran-3-carboxylate |
| SMILES | COC(=O)c1cc(CNc2ncccc2F)oc1C |
| InChI | InChI=1S/C13H13FN2O3/c1-8-10(13(17)18-2)6-9(19-8)7-16-12-11(14)4-3-5-15-12/h3-6H,7H2,1-2H3,(H,15,16) |
| InChIKey | OBHYWICJPNCYSJ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.26 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |