C11H11FN2O — CID 62734741
3-fluoro-N-[(5-methylfuran-2-yl)methyl]pyridin-2-amine (PubChem CID 62734741) has the molecular formula C11H11FN2O and a molecular weight of 206.22 g/mol. Its IUPAC name is 3-fluoro-N-[(5-methylfuran-2-yl)methyl]pyridin-2-amine.
| Compound Name | 3-fluoro-N-[(5-methylfuran-2-yl)methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 62734741 |
| Molecular Formula | C11H11FN2O |
| Molecular Weight | 206.22 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 3-fluoro-N-[(5-methylfuran-2-yl)methyl]pyridin-2-amine |
| SMILES | Cc1ccc(CNc2ncccc2F)o1 |
| InChI | InChI=1S/C11H11FN2O/c1-8-4-5-9(15-8)7-14-11-10(12)3-2-6-13-11/h2-6H,7H2,1H3,(H,13,14) |
| InChIKey | NKUPJLOFZCLTPW-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.22 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |