C12H11N3O — CID 62523720
2-[(5-methylfuran-2-yl)methylamino]pyridine-3-carbonitrile (PubChem CID 62523720) has the molecular formula C12H11N3O and a molecular weight of 213.24 g/mol. Its IUPAC name is 2-[(5-methylfuran-2-yl)methylamino]pyridine-3-carbonitrile.
| Compound Name | 2-[(5-methylfuran-2-yl)methylamino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 62523720 |
| Molecular Formula | C12H11N3O |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | 2-[(5-methylfuran-2-yl)methylamino]pyridine-3-carbonitrile |
| SMILES | Cc1ccc(CNc2ncccc2C#N)o1 |
| InChI | InChI=1S/C12H11N3O/c1-9-4-5-11(16-9)8-15-12-10(7-13)3-2-6-14-12/h2-6H,8H2,1H3,(H,14,15) |
| InChIKey | CTRLXHLQXATNMS-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |