C13H11N3O — CID 113228777
2-[(2-hydroxyphenyl)methylamino]pyridine-3-carbonitrile (PubChem CID 113228777) has the molecular formula C13H11N3O and a molecular weight of 225.25 g/mol. Its IUPAC name is 2-[(2-hydroxyphenyl)methylamino]pyridine-3-carbonitrile.
| Compound Name | 2-[(2-hydroxyphenyl)methylamino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 113228777 |
| Molecular Formula | C13H11N3O |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | 2-[(2-hydroxyphenyl)methylamino]pyridine-3-carbonitrile |
| SMILES | N#Cc1cccnc1NCc1ccccc1O |
| InChI | InChI=1S/C13H11N3O/c14-8-10-5-3-7-15-13(10)16-9-11-4-1-2-6-12(11)17/h1-7,17H,9H2,(H,15,16) |
| InChIKey | YCRVEYLDMXKDRM-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 68.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|